EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O3 |
| Net Charge | 0 |
| Average Mass | 146.146 |
| Monoisotopic Mass | 146.06914 |
| SMILES | NC(=O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | ZDXPYRJPNDTMRX-VKHMYHEASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-glutamine zwitterion (CHEBI:58359) has role metabolite (CHEBI:25212) |
| L-glutamine zwitterion (CHEBI:58359) is a amino-acid zwitterion (CHEBI:35238) |
| L-glutamine zwitterion (CHEBI:58359) is a polar amino acid zwitterion (CHEBI:62031) |
| L-glutamine zwitterion (CHEBI:58359) is tautomer of L-glutamine (CHEBI:18050) |
| Incoming Relation(s) |
| N5-(cytidine 5'-diphosphoramidyl)-L-glutamine(2−) (CHEBI:141583) has functional parent L-glutamine zwitterion (CHEBI:58359) |
| L-glutamine (CHEBI:18050) is tautomer of L-glutamine zwitterion (CHEBI:58359) |
| IUPAC Name |
|---|
| (2S)-5-amino-2-azaniumyl-5-oxopentanoate |
| Synonym | Source |
|---|---|
| (2S)-5-amino-2-ammonio-5-oxopentanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| L-glutamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| GLN | MetaCyc |
| Citations |
|---|