EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O5 |
| Net Charge | 0 |
| Average Mass | 240.255 |
| Monoisotopic Mass | 240.09977 |
| SMILES | COc1cc(CCC(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C12H16O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h6-7H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | ZCYXGVJUZBKJAI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,5-trimethoxydihydrocinnamic acid (CHEBI:583580) has functional parent propionic acid (CHEBI:30768) |
| 3,4,5-trimethoxydihydrocinnamic acid (CHEBI:583580) is a monocarboxylic acid (CHEBI:25384) |
| 3,4,5-trimethoxydihydrocinnamic acid (CHEBI:583580) is conjugate acid of 3,4,5-trimethoxydihydrocinnamate (CHEBI:58962) |
| Incoming Relation(s) |
| 3,4,5-trimethoxydihydrocinnamate (CHEBI:58962) is conjugate base of 3,4,5-trimethoxydihydrocinnamic acid (CHEBI:583580) |
| IUPAC Name |
|---|
| 3-(3,4,5-trimethoxyphenyl)propanoic acid |
| Synonyms | Source |
|---|---|
| 3-(3,4,5-Trimethoxyphenyl)propanoic acid | NIST Chemistry WebBook |
| 3,4,5-Trimethoxyphenylpropionic acid | NIST Chemistry WebBook |
| β-(3,4,5-Trimethoxy phenyl)propionic acid | NIST Chemistry WebBook |
| 3-(3',4',5'-trimethoxyphenyl)propionic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1471912 | Reaxys |
| CAS:25173-72-2 | ChemIDplus |
| CAS:25173-72-2 | NIST Chemistry WebBook |
| Citations |
|---|