EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N2O3 |
| Net Charge | +1 |
| Average Mass | 163.197 |
| Monoisotopic Mass | 163.10772 |
| SMILES | [NH3+]C[C@H](O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N2O3/c7-3-4(9)1-2-5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/p+1/t4-,5+/m1/s1 |
| InChIKey | YSMODUONRAFBET-UHNVWZDZSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythro-5-hydroxy-L-lysinium(1+) (CHEBI:58357) has role human metabolite (CHEBI:77746) |
| erythro-5-hydroxy-L-lysinium(1+) (CHEBI:58357) is a α-amino-acid cation (CHEBI:33719) |
| erythro-5-hydroxy-L-lysinium(1+) (CHEBI:58357) is conjugate acid of erythro-5-hydroxy-L-lysine (CHEBI:18040) |
| Incoming Relation(s) |
| erythro-5-hydroxy-L-lysine (CHEBI:18040) is conjugate base of erythro-5-hydroxy-L-lysinium(1+) (CHEBI:58357) |
| IUPAC Name |
|---|
| 2,6-diazaniumyl-2,3,4,6-tetradeoxy-L-erythro-hexonate |
| Synonyms | Source |
|---|---|
| (2S,5R)-2,6-diazaniumyl-5-hydroxyhexanoate | ChEBI |
| erythro-5-hydroxy-L-lysinium | ChEBI |
| erythro-5-hydroxy-L-lysinium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| (5R)-5-hydroxy-L-lysine | UniProt |