EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N4O9P2 |
| Net Charge | -2 |
| Average Mass | 348.145 |
| Monoisotopic Mass | 348.02470 |
| SMILES | [NH2+]=C(NCCOP(=O)([O-])OC[C@H]([NH3+])C(=O)[O-])NP(=O)([O-])[O-] |
| InChI | InChI=1S/C6H16N4O9P2/c7-4(5(11)12)3-19-21(16,17)18-2-1-9-6(8)10-20(13,14)15/h4H,1-3,7H2,(H,11,12)(H,16,17)(H5,8,9,10,13,14,15)/p-2/t4-/m0/s1 |
| InChIKey | QOYUHKALUMVCHB-BYPYZUCNSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-phosphonato-L-lombricine(2−) (CHEBI:58356) is a organophosphate oxoanion (CHEBI:58945) |
| N-phosphonato-L-lombricine(2−) (CHEBI:58356) is a α-amino-acid anion (CHEBI:33558) |
| N-phosphonato-L-lombricine(2−) (CHEBI:58356) is conjugate base of N-phospho-L-lombricine (CHEBI:18039) |
| Incoming Relation(s) |
| N-phospho-L-lombricine (CHEBI:18039) is conjugate acid of N-phosphonato-L-lombricine(2−) (CHEBI:58356) |
| IUPAC Name |
|---|
| (11S)-11-azaniumyl-3-iminio-1,1,8-trioxido-7,9-dioxa-2,4-diaza-1,8-diphosphadodecan-12-oate 1,8-dioxide |
| Synonyms | Source |
|---|---|
| N-phosphonato-L-lombricine | ChEBI |
| N-phosphonato-L-lombricine dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| N-phospho-L-lombricine | UniProt |