EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O2 |
| Net Charge | 0 |
| Average Mass | 246.310 |
| Monoisotopic Mass | 246.13683 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C14H18N2O2/c1-16(2,3)13(14(17)18)8-10-9-15-12-7-5-4-6-11(10)12/h4-7,9,13,15H,8H2,1-3H3/t13-/m0/s1 |
| InChIKey | AOHCBEAZXHZMOR-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina suberosa (ncbitaxon:1288013) | seed (BTO:0001226) | PubMed (5348524) | |
| Pisolithus microcarpus (ncbitaxon:178872) | - | PubMed (17370110) | |
| Pisolithus tinctorius (ncbitaxon:37468) | - | PubMed (9951730) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypaphorine (CHEBI:5832) has role fungal metabolite (CHEBI:76946) |
| hypaphorine (CHEBI:5832) has role plant metabolite (CHEBI:76924) |
| hypaphorine (CHEBI:5832) has role xenobiotic (CHEBI:35703) |
| hypaphorine (CHEBI:5832) is a L-tryptophan derivative (CHEBI:47994) |
| hypaphorine (CHEBI:5832) is a amino-acid betaine (CHEBI:22860) |
| hypaphorine (CHEBI:5832) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| (2S)-3-(1H-indol-3-yl)-2-(trimethylazaniumyl)propanoate |
| Synonyms | Source |
|---|---|
| N,N,N-trimethyltryptophan betaine | ChEBI |
| Glyyunnanenine | ChemIDplus |
| (+)-Hypaphorine | ChemIDplus |
| Hypaphorine | KEGG COMPOUND |
| Lenticin | KEGG COMPOUND |
| L-Hypaphorine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| Nα,Nα,Nα-trimethyl-L-tryptophan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00001740 | KNApSAcK |
| C09213 | KEGG COMPOUND |
| HMDB0061115 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3558356 | Reaxys |
| CAS:487-58-1 | KEGG COMPOUND |
| CAS:487-58-1 | ChemIDplus |
| Citations |
|---|