EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5832 - hypaphorine
| Formula | C14H18N2O2 |
| Net Charge | 0 |
| Average Mass | 246.310 |
| Monoisotopic Mass | 246.13683 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C14H18N2O2/c1-16(2,3)13(14(17)18)8-10-9-15-12-7-5-4-6-11(10)12/h4-7,9,13,15H,8H2,1-3H3/t13-/m0/s1 |
| InChIKey | AOHCBEAZXHZMOR-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisolithus tinctorius (ncbitaxon:37468) | - | PubMed (9951730) | |
| Pisolithus microcarpus (ncbitaxon:178872) | - | PubMed (17370110) | |
| Erythrina suberosa (ncbitaxon:1288013) | seed (BTO:0001226) | PubMed (5348524) |
| Roles Classification |
|---|
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypaphorine (CHEBI:5832) has role fungal metabolite (CHEBI:76946) |
| hypaphorine (CHEBI:5832) has role plant metabolite (CHEBI:76924) |
| hypaphorine (CHEBI:5832) has role xenobiotic (CHEBI:35703) |
| hypaphorine (CHEBI:5832) is a L-tryptophan derivative (CHEBI:47994) |
| hypaphorine (CHEBI:5832) is a amino-acid betaine (CHEBI:22860) |
| hypaphorine (CHEBI:5832) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| (2S)-3-(1H-indol-3-yl)-2-(trimethylazaniumyl)propanoate |
| Synonyms | Source |
|---|---|
| Hypaphorine | KEGG COMPOUND |
| Lenticin | KEGG COMPOUND |
| Tryptophan betaine | ChemIDplus |
| L-Hypaphorine | ChemIDplus |
| Glyyunnanenine | ChemIDplus |
| (+)-Hypaphorine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| Nα,Nα,Nα-trimethyl-L-tryptophan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C09213 | KEGG COMPOUND |
| C00001740 | KNApSAcK |
| HMDB0061115 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3558356 | Reaxys |
| CAS:487-58-1 | KEGG COMPOUND |
| CAS:487-58-1 | ChemIDplus |
| Citations |
|---|