EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15N2O4 |
| Net Charge | -1 |
| Average Mass | 263.273 |
| Monoisotopic Mass | 263.10373 |
| SMILES | NC(=O)CC[C@H](NC(=O)Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C13H16N2O4/c14-11(16)7-6-10(13(18)19)15-12(17)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,14,16)(H,15,17)(H,18,19)/p-1/t10-/m0/s1 |
| InChIKey | JFLIEFSWGNOPJJ-JTQLQIEISA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-phenylacetyl-L-glutaminate (CHEBI:58310) has role human metabolite (CHEBI:77746) |
| N2-phenylacetyl-L-glutaminate (CHEBI:58310) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N2-phenylacetyl-L-glutaminate (CHEBI:58310) is conjugate base of N2-phenylacetyl-L-glutamine (CHEBI:17884) |
| Incoming Relation(s) |
| N2-phenylacetyl-L-glutamine (CHEBI:17884) is conjugate acid of N2-phenylacetyl-L-glutaminate (CHEBI:58310) |
| IUPAC Name |
|---|
| N2-(phenylacetyl)-L-glutaminate |
| Synonyms | Source |
|---|---|
| (2S)-5-amino-5-oxo-2-[(phenylacetyl)amino]pentanoate | IUPAC |
| N2-phenylacetyl-L-glutaminate(1−) | ChEBI |
| N2-phenylacetyl-L-glutaminate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| N2-phenylacetyl-L-glutamine | UniProt |