EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O5 |
| Net Charge | -1 |
| Average Mass | 197.166 |
| Monoisotopic Mass | 197.04555 |
| SMILES | O=C([O-])C(O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H10O5/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8,10-12H,4H2,(H,13,14)/p-1 |
| InChIKey | PAFLSMZLRSPALU-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,4-dihydroxyphenyl)lactate (CHEBI:58279) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 3-(3,4-dihydroxyphenyl)lactate (CHEBI:58279) is conjugate base of 3-(3,4-dihydroxyphenyl)lactic acid (CHEBI:17807) |
| Incoming Relation(s) |
| (2R)-3-(3,4-dihydroxyphenyl)lactate (CHEBI:71492) is a 3-(3,4-dihydroxyphenyl)lactate (CHEBI:58279) |
| 3-(3,4-dihydroxyphenyl)lactic acid (CHEBI:17807) is conjugate acid of 3-(3,4-dihydroxyphenyl)lactate (CHEBI:58279) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate |
| Synonyms | Source |
|---|---|
| 3-(3,4-dihydroxyphenyl)lactate(1−) | ChEBI |
| 3-(3,4-dihydroxyphenyl)lactate anion | ChEBI |