EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H20N3O5S |
| Net Charge | -1 |
| Average Mass | 486.529 |
| Monoisotopic Mass | 486.11292 |
| SMILES | O=S(=O)([O-])Oc1c(Cc2ccccc2)nc2c(Cc3ccccc3)nc(-c3ccc(O)cc3)cn12 |
| InChI | InChI=1S/C26H21N3O5S/c30-21-13-11-20(12-14-21)24-17-29-25(22(27-24)15-18-7-3-1-4-8-18)28-23(26(29)34-35(31,32)33)16-19-9-5-2-6-10-19/h1-14,17,30H,15-16H2,(H,31,32,33)/p-1 |
| InChIKey | FWTNBXHOBWPZGV-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Renilla luciferyl sulfate(1−) (CHEBI:58242) is a aryl sulfate oxoanion (CHEBI:139371) |
| Renilla luciferyl sulfate(1−) (CHEBI:58242) is conjugate base of Renilla luciferyl sulfate (CHEBI:17706) |
| Incoming Relation(s) |
| Renilla luciferyl sulfate (CHEBI:17706) is conjugate acid of Renilla luciferyl sulfate(1−) (CHEBI:58242) |
| IUPAC Name |
|---|
| 2,8-dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl sulfate |
| Synonyms | Source |
|---|---|
| Renilla luciferyl sulfate | ChEBI |
| Renilla luciferyl sulfate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| luciferyl sulfate | UniProt |