EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O14P3 |
| Net Charge | -3 |
| Average Mass | 480.132 |
| Monoisotopic Mass | 479.96268 |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H16N3O14P3/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H2,10,11,15)(H2,16,17,18)/p-3/t4-,6-,7-,8-/m1/s1 |
| InChIKey | PCDQPRRSZKQHHS-XVFCMESISA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CTP(3−) (CHEBI:58231) is a ribonucleoside triphosphate oxoanion (CHEBI:59724) |
| CTP(3−) (CHEBI:58231) is conjugate base of CTP (CHEBI:17677) |
| Incoming Relation(s) |
| CTP (CHEBI:17677) is conjugate acid of CTP(3−) (CHEBI:58231) |
| IUPAC Name |
|---|
| 5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]cytidine |
| Synonyms | Source |
|---|---|
| CTP trianion | ChEBI |
| cytidine 5'-triphosphate | ChEBI |
| cytidine 5'-triphosphate(3−) | ChEBI |
| cytidine 5'-triphosphate trianion | ChEBI |