EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9N4O6 |
| Net Charge | -1 |
| Average Mass | 281.204 |
| Monoisotopic Mass | 281.05276 |
| SMILES | O=C([O-])[C@H]1O[C@@H](n2cnc3c(=O)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H10N4O6/c15-4-5(16)9(20-6(4)10(18)19)14-2-13-3-7(14)11-1-12-8(3)17/h1-2,4-6,9,15-16H,(H,18,19)(H,11,12,17)/p-1/t4-,5+,6-,9+/m0/s1 |
| InChIKey | YALKLGGFZOUJBN-SOVPELCUSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-riburonosylhypoxanthine(1−) (CHEBI:58218) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 9-riburonosylhypoxanthine(1−) (CHEBI:58218) is conjugate base of 9-riburonosylhypoxanthine (CHEBI:17643) |
| Incoming Relation(s) |
| 9-riburonosylhypoxanthine (CHEBI:17643) is conjugate acid of 9-riburonosylhypoxanthine(1−) (CHEBI:58218) |
| IUPAC Name |
|---|
| 9-(β-D-ribofuranosyluronosyl)-1,9-dihydro-6H-purin-6-one |
| Synonym | Source |
|---|---|
| 9-riburonosylhypoxanthine anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 9-riburonosylhypoxanthine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-7102 | MetaCyc |