EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6Cl5O |
| Net Charge | -1 |
| Average Mass | 265.330 |
| Monoisotopic Mass | 262.83973 |
| SMILES | [O-]c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6HCl5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H/p-1 |
| InChIKey | IZUPBVBPLAPZRR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentachlorophenolate (CHEBI:58217) has role human xenobiotic metabolite (CHEBI:76967) |
| pentachlorophenolate (CHEBI:58217) is a phenolate anion (CHEBI:50525) |
| pentachlorophenolate (CHEBI:58217) is conjugate base of pentachlorophenol (CHEBI:17642) |
| Incoming Relation(s) |
| pentachlorophenol (CHEBI:17642) is conjugate acid of pentachlorophenolate (CHEBI:58217) |
| Synonyms | Source |
|---|---|
| 2,3,4,5,6-pentachlorobenzen-1-olate | ChEBI |
| pentachlorophenolate | ChEBI |
| pentachlorophenolate(1−) | ChEBI |
| pentachlorophenolate anion | ChEBI |
| pentachlorophenoxide | ChEBI |
| UniProt Name | Source |
|---|---|
| pentachlorophenol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3613001 | Reaxys |
| Citations |
|---|