EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N5O17P4 |
| Net Charge | -6 |
| Average Mass | 597.112 |
| Monoisotopic Mass | 596.91333 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@H](OP(=O)([O-])OP(=O)([O-])[O-])[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H17N5O17P4/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6(30-36(26,27)32-34(21,22)23)3(29-9)1-28-35(24,25)31-33(18,19)20/h2-3,5-6,9,16H,1H2,(H,24,25)(H,26,27)(H2,18,19,20)(H2,21,22,23)(H3,11,13,14,17)/p-6/t3-,5-,6-,9-/m1/s1 |
| InChIKey | BUFLLCUFNHESEH-UUOKFMHZSA-H |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanosine 3',5'-bis(diphosphate)(6−) (CHEBI:58215) is a organophosphate oxoanion (CHEBI:58945) |
| guanosine 3',5'-bis(diphosphate)(6−) (CHEBI:58215) is conjugate base of guanosine 3',5'-bis(diphosphate) (CHEBI:17633) |
| guanosine 3',5'-bis(diphosphate)(6−) (CHEBI:58215) is conjugate base of guanosine 3',5'-bis(diphosphate)(5−) (CHEBI:77828) |
| Incoming Relation(s) |
| guanosine 3',5'-bis(diphosphate) (CHEBI:17633) is conjugate acid of guanosine 3',5'-bis(diphosphate)(6−) (CHEBI:58215) |
| guanosine 3',5'-bis(diphosphate)(5−) (CHEBI:77828) is conjugate acid of guanosine 3',5'-bis(diphosphate)(6−) (CHEBI:58215) |
| IUPAC Name |
|---|
| 3',5'-bis-O-[(phosphonatooxy)phosphinato]guanosine |
| Synonym | Source |
|---|---|
| guanosine 3',5'-bis(diphosphate) hexaanion | ChEBI |