EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:582124 - myriocin
| Formula | C21H39NO6 |
| Net Charge | 0 |
| Average Mass | 401.544 |
| Monoisotopic Mass | 401.27774 |
| SMILES | CCCCCCC(=O)CCCCCC/C=C/C[C@@H](O)[C@H](O)[C@@](N)(CO)C(=O)O |
| InChI | InChI=1S/C21H39NO6/c1-2-3-4-10-13-17(24)14-11-8-6-5-7-9-12-15-18(25)19(26)21(22,16-23)20(27)28/h9,12,18-19,23,25-26H,2-8,10-11,13-16,22H2,1H3,(H,27,28)/b12-9+/t18-,19+,21+/m1/s1 |
| InChIKey | ZZIKIHCNFWXKDY-GNTQXERDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isaria sinclairii (fungorum:254719) | - | PubMed (21456524) | Entomopathogenic fungus |
| Myriococcum albomyces (fungorum:335011) | - | PubMed (21456524) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of serine palmitoyltransferase (EC 2.3.1.50). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myriocin (CHEBI:582124) has role antifungal agent (CHEBI:35718) |
| myriocin (CHEBI:582124) has role antimicrobial agent (CHEBI:33281) |
| myriocin (CHEBI:582124) has role antineoplastic agent (CHEBI:35610) |
| myriocin (CHEBI:582124) has role apoptosis inducer (CHEBI:68495) |
| myriocin (CHEBI:582124) has role EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor (CHEBI:59647) |
| myriocin (CHEBI:582124) has role fungal metabolite (CHEBI:76946) |
| myriocin (CHEBI:582124) has role immunosuppressive agent (CHEBI:35705) |
| myriocin (CHEBI:582124) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| myriocin (CHEBI:582124) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| myriocin (CHEBI:582124) is a sphingoid (CHEBI:35785) |
| myriocin (CHEBI:582124) is a α-amino fatty acid (CHEBI:59755) |
| IUPAC Name |
|---|
| (2S,3R,4R,6E)-2-amino-3,4-dihydroxy-2-(hydroxymethyl)-14-oxoicos-6-enoic acid |
| Synonyms | Source |
|---|---|
| (2S,3R,4R,6E)-2-amino-3,4-dihydroxy-2-(hydroxymethyl)-14-oxo-6-eicosenoic acid | ChEBI |
| (2S,3R,4R)-(E)-2-amino-3,4-dihydroxy-2-hydroxymethyl-14-oxoeicos-6-enoic acid | ChEBI |
| antibiotic ISP-1 | ChEBI |
| antibiotic ISP-I | ChEBI |
| ISP-1 | KEGG COMPOUND |
| ISP-I | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00016936 | KNApSAcK |
| C19914 | KEGG COMPOUND |
| LMFA01060203 | LIPID MAPS |
| Myriocin | Wikipedia |
| VRP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5113331 | Reaxys |
| CAS:35891-70-4 | ChemIDplus |
| Citations |
|---|