EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H39NO6 |
| Net Charge | 0 |
| Average Mass | 401.544 |
| Monoisotopic Mass | 401.27774 |
| SMILES | CCCCCCC(=O)CCCCCC/C=C/C[C@@H](O)[C@H](O)[C@@](N)(CO)C(=O)O |
| InChI | InChI=1S/C21H39NO6/c1-2-3-4-10-13-17(24)14-11-8-6-5-7-9-12-15-18(25)19(26)21(22,16-23)20(27)28/h9,12,18-19,23,25-26H,2-8,10-11,13-16,22H2,1H3,(H,27,28)/b12-9+/t18-,19+,21+/m1/s1 |
| InChIKey | ZZIKIHCNFWXKDY-GNTQXERDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isaria sinclairii (fungorum:254719) | - | PubMed (21456524) | Entomopathogenic fungus |
| Myriococcum albomyces (fungorum:335011) | - | PubMed (21456524) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of serine palmitoyltransferase (EC 2.3.1.50). immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myriocin (CHEBI:582124) has role antifungal agent (CHEBI:35718) |
| myriocin (CHEBI:582124) has role antimicrobial agent (CHEBI:33281) |
| myriocin (CHEBI:582124) has role antineoplastic agent (CHEBI:35610) |
| myriocin (CHEBI:582124) has role apoptosis inducer (CHEBI:68495) |
| myriocin (CHEBI:582124) has role EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor (CHEBI:59647) |
| myriocin (CHEBI:582124) has role fungal metabolite (CHEBI:76946) |
| myriocin (CHEBI:582124) has role immunosuppressive agent (CHEBI:35705) |
| myriocin (CHEBI:582124) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| myriocin (CHEBI:582124) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| myriocin (CHEBI:582124) is a sphingoid (CHEBI:35785) |
| myriocin (CHEBI:582124) is a α-amino fatty acid (CHEBI:59755) |
| IUPAC Name |
|---|
| (2S,3R,4R,6E)-2-amino-3,4-dihydroxy-2-(hydroxymethyl)-14-oxoicos-6-enoic acid |
| Synonyms | Source |
|---|---|
| (2S,3R,4R,6E)-2-amino-3,4-dihydroxy-2-(hydroxymethyl)-14-oxo-6-eicosenoic acid | ChEBI |
| (2S,3R,4R)-(E)-2-amino-3,4-dihydroxy-2-hydroxymethyl-14-oxoeicos-6-enoic acid | ChEBI |
| antibiotic ISP-1 | ChEBI |
| antibiotic ISP-I | ChEBI |
| ISP-1 | KEGG COMPOUND |
| ISP-I | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00016936 | KNApSAcK |
| C19914 | KEGG COMPOUND |
| LMFA01060203 | LIPID MAPS |
| Myriocin | Wikipedia |
| VRP | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5113331 | Reaxys |
| CAS:35891-70-4 | ChemIDplus |
| Citations |
|---|