EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O3 |
| Net Charge | 0 |
| Average Mass | 160.173 |
| Monoisotopic Mass | 160.08479 |
| SMILES | CNC(=O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H12N2O3/c1-8-5(9)3-2-4(7)6(10)11/h4H,2-3,7H2,1H3,(H,8,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | ONXPDKGXOOORHB-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-methyl-L-glutamine zwitterion (CHEBI:58200) is a amino-acid zwitterion (CHEBI:35238) |
| N5-methyl-L-glutamine zwitterion (CHEBI:58200) is tautomer of N5-methyl-L-glutamine (CHEBI:17592) |
| Incoming Relation(s) |
| N5-methyl-L-glutamine (CHEBI:17592) is tautomer of N5-methyl-L-glutamine zwitterion (CHEBI:58200) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-(methylamino)-5-oxopentanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-5-(methylamino)-5-oxopentanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| N5-methyl-L-glutamine | UniProt |