EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N5O4 |
| Net Charge | +1 |
| Average Mass | 338.388 |
| Monoisotopic Mass | 338.18228 |
| SMILES | NC(=[NH2+])NCCC[C@H](NC(=O)[C@@H]([NH3+])Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C15H23N5O4/c16-11(8-9-3-5-10(21)6-4-9)13(22)20-12(14(23)24)2-1-7-19-15(17)18/h3-6,11-12,21H,1-2,7-8,16H2,(H,20,22)(H,23,24)(H4,17,18,19)/p+1/t11-,12-/m0/s1 |
| InChIKey | JXNRXNCCROJZFB-RYUDHWBXSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosiniumyl-L-arginine(1+) (CHEBI:58184) is a peptide cation (CHEBI:60194) |
| L-tyrosiniumyl-L-arginine(1+) (CHEBI:58184) is conjugate acid of Tyr-Arg (CHEBI:17537) |
| Incoming Relation(s) |
| Tyr-Arg (CHEBI:17537) is conjugate base of L-tyrosiniumyl-L-arginine(1+) (CHEBI:58184) |
| Synonym | Source |
|---|---|
| L-tyrosiniumyl-L-arginine cation | ChEBI |
| UniProt Name | Source |
|---|---|
| L-tyrosyl-L-arginine | UniProt |