EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N2O |
| Net Charge | +1 |
| Average Mass | 179.243 |
| Monoisotopic Mass | 179.11789 |
| SMILES | [H][C@@]1(c2ccc(O)nc2)CCC[NH+]1C |
| InChI | InChI=1S/C10H14N2O/c1-12-6-2-3-9(12)8-4-5-10(13)11-7-8/h4-5,7,9H,2-3,6H2,1H3,(H,11,13)/p+1/t9-/m0/s1 |
| InChIKey | ATRCOGLZUCICIV-VIFPVBQESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-6-hydroxynicotinium(1+) (CHEBI:58182) is a ammonium ion derivative (CHEBI:35274) |
| (S)-6-hydroxynicotinium(1+) (CHEBI:58182) is a organic cation (CHEBI:25697) |
| (S)-6-hydroxynicotinium(1+) (CHEBI:58182) is conjugate acid of (S)-6-hydroxynicotine (CHEBI:17532) |
| (S)-6-hydroxynicotinium(1+) (CHEBI:58182) is enantiomer of (R)-6-hydroxynicotinium (CHEBI:58413) |
| Incoming Relation(s) |
| (S)-6-hydroxynicotine (CHEBI:17532) is conjugate base of (S)-6-hydroxynicotinium(1+) (CHEBI:58182) |
| (R)-6-hydroxynicotinium (CHEBI:58413) is enantiomer of (S)-6-hydroxynicotinium(1+) (CHEBI:58182) |
| IUPAC Name |
|---|
| (2S)-2-(6-hydroxypyridin-3-yl)-1-methylpyrrolidinium |
| Synonyms | Source |
|---|---|
| (S)-6-hydroxynicotinium | ChEBI |
| (S)-6-hydroxynicotinium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-6-hydroxynicotine | UniProt |