EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O8 |
| Net Charge | 0 |
| Average Mass | 378.377 |
| Monoisotopic Mass | 378.13147 |
| SMILES | [H][C@@]12/C=C3/CC[C@@]4([H])O[C@@]4(C[C@H](OC(=O)C(=C)CO)[C@@]1([H])C(=C)C(=O)O2)[C@H](O)OC3 |
| InChI | InChI=1S/C19H22O8/c1-9(7-20)16(21)26-13-6-19-14(27-19)4-3-11(8-24-18(19)23)5-12-15(13)10(2)17(22)25-12/h5,12-15,18,20,23H,1-4,6-8H2/b11-5-/t12-,13+,14-,15+,18-,19-/m1/s1 |
| InChIKey | VPZCNCFYAPSUAL-LQLHESBKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxyvernolide (CHEBI:5817) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonym | Source |
|---|---|
| Hydroxyvernolide | KEGG COMPOUND |