EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8NO4 |
| Net Charge | -1 |
| Average Mass | 206.177 |
| Monoisotopic Mass | 206.04588 |
| SMILES | Nc1ccccc1C(=O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C10H9NO4/c11-7-4-2-1-3-6(7)8(12)5-9(13)10(14)15/h1-4H,5,11H2,(H,14,15)/p-1 |
| InChIKey | CAOVWYZQMPNAFJ-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-aminophenyl)-2,4-dioxobutanoate (CHEBI:58147) has role human metabolite (CHEBI:77746) |
| 4-(2-aminophenyl)-2,4-dioxobutanoate (CHEBI:58147) is a dioxo monocarboxylic acid anion (CHEBI:35979) |
| 4-(2-aminophenyl)-2,4-dioxobutanoate (CHEBI:58147) is conjugate base of 4-(2-aminophenyl)-2,4-dioxobutanoic acid (CHEBI:17442) |
| Incoming Relation(s) |
| 4-(2-aminophenyl)-2,4-dioxobutanoic acid (CHEBI:17442) is conjugate acid of 4-(2-aminophenyl)-2,4-dioxobutanoate (CHEBI:58147) |
| IUPAC Names |
|---|
| 4-(2-aminophenyl)-2,4-dioxobutanoate |
| 4-(2-aminophenyl)-2,4-dioxobutanoate(1−) |
| 4-(2-aminophenyl)-2,4-dioxobutanoate anion |
| UniProt Name | Source |
|---|---|
| 4-(2-aminophenyl)-2,4-dioxobutanoate | UniProt |