EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H16N4 |
| Net Charge | +2 |
| Average Mass | 132.211 |
| Monoisotopic Mass | 132.13640 |
| SMILES | NC(=[NH2+])NCCCC[NH3+] |
| InChI | InChI=1S/C5H14N4/c6-3-1-2-4-9-5(7)8/h1-4,6H2,(H4,7,8,9)/p+2 |
| InChIKey | QYPPJABKJHAVHS-UHFFFAOYSA-P |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| agmatinium(2+) (CHEBI:58145) has role human metabolite (CHEBI:77746) |
| agmatinium(2+) (CHEBI:58145) is a guanidinium ion (CHEBI:60251) |
| agmatinium(2+) (CHEBI:58145) is conjugate acid of agmatine (CHEBI:17431) |
| Incoming Relation(s) |
| agmatine (CHEBI:17431) is conjugate base of agmatinium(2+) (CHEBI:58145) |
| IUPAC Name |
|---|
| {amino[(4-azaniumylbutyl)amino]methylidene}azanium |
| Synonyms | Source |
|---|---|
| agmatinium | ChEBI |
| agmatinium dication | ChEBI |
| UniProt Name | Source |
|---|---|
| agmatine | UniProt |