EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H33N9O12 |
| Net Charge | -4 |
| Average Mass | 699.634 |
| Monoisotopic Mass | 699.22706 |
| SMILES | Nc1nc2c(c(=O)n1)N[C@@H](CNc1ccc(C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])C(=O)[O-])C(=O)[O-])cc1)CN2 |
| InChI | InChI=1S/C29H37N9O12/c30-29-37-23-22(25(44)38-29)33-15(12-32-23)11-31-14-3-1-13(2-4-14)24(43)36-18(28(49)50)6-9-20(40)34-16(26(45)46)5-8-19(39)35-17(27(47)48)7-10-21(41)42/h1-4,15-18,31,33H,5-12H2,(H,34,40)(H,35,39)(H,36,43)(H,41,42)(H,45,46)(H,47,48)(H,49,50)(H4,30,32,37,38,44)/p-4/t15-,16-,17-,18-/m0/s1 |
| InChIKey | RXWVHRYZTWZATH-XSLAGTTESA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydropteroyltri-L-glutamate(4−) (CHEBI:58140) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| tetrahydropteroyltri-L-glutamate(4−) (CHEBI:58140) is a peptide anion (CHEBI:60334) |
| tetrahydropteroyltri-L-glutamate(4−) (CHEBI:58140) is conjugate base of tetrahydropteroyltri-L-glutamic acid (CHEBI:17420) |
| Incoming Relation(s) |
| tetrahydropteroyltri-L-glutamic acid (CHEBI:17420) is conjugate acid of tetrahydropteroyltri-L-glutamate(4−) (CHEBI:58140) |
| Synonym | Source |
|---|---|
| tetrahydropteroyltri-L-glutamate tetraanion | ChEBI |
| UniProt Name | Source |
|---|---|
| tetrahydropteroyltri-L-glutamate | UniProt |