EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6ClNO2 |
| Net Charge | 0 |
| Average Mass | 123.539 |
| Monoisotopic Mass | 123.00871 |
| SMILES | [NH3+][C@@H](CCl)C(=O)[O-] |
| InChI | InChI=1S/C3H6ClNO2/c4-1-2(5)3(6)7/h2H,1,5H2,(H,6,7)/t2-/m0/s1 |
| InChIKey | ASBJGPTTYPEMLP-REOHCLBHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-L-alanine zwitterion (CHEBI:58132) is a amino-acid zwitterion (CHEBI:35238) |
| 3-chloro-L-alanine zwitterion (CHEBI:58132) is tautomer of 3-chloro-L-alanine (CHEBI:17403) |
| Incoming Relation(s) |
| 3-chloro-L-alanine (CHEBI:17403) is tautomer of 3-chloro-L-alanine zwitterion (CHEBI:58132) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-chloropropanoate |
| Synonym | Source |
|---|---|
| (2R)-2-ammonio-3-chloropropanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| 3-chloro-L-alanine | UniProt |