EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O24P6 |
| Net Charge | -12 |
| Average Mass | 647.934 |
| Monoisotopic Mass | 647.77405 |
| SMILES | O=P([O-])([O-])O[C@H]1[C@H](OP(=O)([O-])[O-])[C@@H](OP(=O)([O-])[O-])[C@H](OP(=O)([O-])[O-])[C@@H](OP(=O)([O-])[O-])[C@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C6H18O24P6/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)/p-12/t1-,2-,3-,4+,5-,6- |
| InChIKey | IMQLKJBTEOYOSI-GPIVLXJGSA-B |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myo-inositol hexakisphosphate(12−) (CHEBI:58130) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| myo-inositol hexakisphosphate(12−) (CHEBI:58130) has role cofactor (CHEBI:23357) |
| myo-inositol hexakisphosphate(12−) (CHEBI:58130) has role human metabolite (CHEBI:77746) |
| myo-inositol hexakisphosphate(12−) (CHEBI:58130) is a inositol phosphate oxoanion (CHEBI:76301) |
| myo-inositol hexakisphosphate(12−) (CHEBI:58130) is conjugate base of myo-inositol hexakisphosphate (CHEBI:17401) |
| Incoming Relation(s) |
| myo-inositol hexakisphosphate (CHEBI:17401) is conjugate acid of myo-inositol hexakisphosphate(12−) (CHEBI:58130) |
| IUPAC Names |
|---|
| (1R,2S,3r,4R,5S,6s)-cyclohexane-1,2,3,4,5,6-hexayl hexakis(phosphate) |
| 1D-myo-inositol hexakisphosphate |
| myo-inositol hexakisphosphate |
| Synonym | Source |
|---|---|
| [2,3,4,5,6-pentakis(phosphonatooxy)cyclohexyl] phosphate | ChEBI |
| UniProt Name | Source |
|---|---|
| 1D-myo-inositol hexakisphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3886124 | Beilstein |