EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7O4 |
| Net Charge | -1 |
| Average Mass | 179.151 |
| Monoisotopic Mass | 179.03498 |
| SMILES | O=C([O-])/C=C\c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/p-1/b4-2- |
| InChIKey | QAIPRVGONGVQAS-RQOWECAXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-caffeate (CHEBI:58129) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| cis-caffeate (CHEBI:58129) is conjugate base of cis-caffeic acid (CHEBI:17395) |
| Incoming Relation(s) |
| cis-caffeic acid (CHEBI:17395) is conjugate acid of cis-caffeate (CHEBI:58129) |
| IUPAC Name |
|---|
| (2Z)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| (2Z)-3-(3,4-dihydroxyphenyl)acrylate | IUPAC |
| cis-caffeate(1−) | ChEBI |
| cis-caffeate anion | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-8098 | MetaCyc |