EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H14N4O3P |
| Net Charge | -1 |
| Average Mass | 209.166 |
| Monoisotopic Mass | 209.08090 |
| SMILES | NC(=[NH2+])NCCCCNP(=O)([O-])[O-] |
| InChI | InChI=1S/C5H15N4O3P/c6-5(7)8-3-1-2-4-9-13(10,11)12/h1-4H2,(H4,6,7,8)(H3,9,10,11,12)/p-1 |
| InChIKey | UYYDRBKHPQBWOH-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N4-phosphonatoagmatine(1−) (CHEBI:58119) is a organic phosphoramidate anion (CHEBI:60345) |
| N4-phosphonatoagmatine(1−) (CHEBI:58119) is conjugate base of N4-phosphoagmatine (CHEBI:17358) |
| Incoming Relation(s) |
| N4-phosphoagmatine (CHEBI:17358) is conjugate acid of N4-phosphonatoagmatine(1−) (CHEBI:58119) |
| IUPAC Name |
|---|
| (4-{[amino(iminio)methyl]amino}butyl)phosphoramidoate |
| Synonyms | Source |
|---|---|
| N4-phosphonatoagmatine | ChEBI |
| N4-phosphonatoagmatine anion | ChEBI |
| UniProt Name | Source |
|---|---|
| N4-phosphoagmatine | UniProt |