EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO4 |
| Net Charge | 0 |
| Average Mass | 305.374 |
| Monoisotopic Mass | 305.16271 |
| SMILES | [NH3+]C[C@H]1CC[C@H](C(=O)Oc2ccc(CCC(=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H23NO4/c18-11-13-1-6-14(7-2-13)17(21)22-15-8-3-12(4-9-15)5-10-16(19)20/h3-4,8-9,13-14H,1-2,5-7,10-11,18H2,(H,19,20)/t13-,14- |
| InChIKey | FHRSHSOEWXUORL-HDJSIYSDSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cetraxate zwitterion (CHEBI:58112) is a amino-acid zwitterion (CHEBI:35238) |
| cetraxate zwitterion (CHEBI:58112) is tautomer of cetraxate (CHEBI:17340) |
| Incoming Relation(s) |
| cetraxate (CHEBI:17340) is tautomer of cetraxate zwitterion (CHEBI:58112) |
| IUPAC Name |
|---|
| 3-[4-({[trans-4-(azaniumylmethyl)cyclohexyl]carbonyl}oxy)phenyl]propanoate |
| UniProt Name | Source |
|---|---|
| cetraxate | UniProt |