EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4ClO4 |
| Net Charge | -1 |
| Average Mass | 175.547 |
| Monoisotopic Mass | 174.98036 |
| SMILES | O=C([O-])CC1(Cl)C=CC(=O)O1 |
| InChI | InChI=1S/C6H5ClO4/c7-6(3-4(8)9)2-1-5(10)11-6/h1-2H,3H2,(H,8,9)/p-1 |
| InChIKey | WGZZDRVKIXVYEI-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-chloro-5-oxo-2,5-dihydro-2-furyl)acetate (CHEBI:58109) is a monocarboxylic acid anion (CHEBI:35757) |
| (2-chloro-5-oxo-2,5-dihydro-2-furyl)acetate (CHEBI:58109) is conjugate base of (2-chloro-5-oxo-2,5-dihydro-2-furyl)acetic acid (CHEBI:17337) |
| Incoming Relation(s) |
| (R)-(2-chloro-5-oxo-2,5-dihydro-2-furyl)acetate (CHEBI:85538) is a (2-chloro-5-oxo-2,5-dihydro-2-furyl)acetate (CHEBI:58109) |
| (2-chloro-5-oxo-2,5-dihydro-2-furyl)acetic acid (CHEBI:17337) is conjugate acid of (2-chloro-5-oxo-2,5-dihydro-2-furyl)acetate (CHEBI:58109) |
| IUPAC Name |
|---|
| (2-chloro-5-oxo-2,5-dihydrofuran-2-yl)acetate |
| Synonyms | Source |
|---|---|
| 2-(2-chloro-5-oxo-2,5-dihydrofuran-2-yl)acetate | ChEBI |
| 2-(2-chloro-5-oxo-2,5-dihydrofuran-2-yl)acetate anion | ChEBI |
| (2-chloro-5-oxo-2,5-dihydro-2-furyl)acetate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-chloro-5-oxo-2,5-dihydro-2-furylacetate | UniProt |