EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O13P3R |
| Net Charge | -3 |
| Average Mass (excl. R groups) | 370.039 |
| Monoisotopic Mass (excl. R groups) | 369.92560 |
| SMILES | *[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]1O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nucleoside 5'-triphoshate(3−) (CHEBI:58104) is a ribonucleoside triphosphate oxoanion (CHEBI:59724) |
| nucleoside 5'-triphoshate(3−) (CHEBI:58104) is conjugate acid of nucleoside 5'-triphoshate(4−) (CHEBI:61557) |
| nucleoside 5'-triphoshate(3−) (CHEBI:58104) is conjugate base of nucleoside 5'-triphoshate (CHEBI:17326) |
| Incoming Relation(s) |
| nucleoside 5'-triphoshate (CHEBI:17326) is conjugate acid of nucleoside 5'-triphoshate(3−) (CHEBI:58104) |
| nucleoside 5'-triphoshate(4−) (CHEBI:61557) is conjugate base of nucleoside 5'-triphoshate(3−) (CHEBI:58104) |
| Synonyms | Source |
|---|---|
| nucleoside triphosphate trianion | ChEBI |
| ribonucleoside triphosphate(3−) | ChEBI |
| NTP trianion | ChEBI |
| ribonucleoside triphosphate trianion | ChEBI |
| NTP(3−) | ChEBI |