EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20NO3 |
| Net Charge | +1 |
| Average Mass | 286.351 |
| Monoisotopic Mass | 286.14377 |
| SMILES | [H][C@@]12C=C[C@H](O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CC[NH+](C)[C@@H]2C5 |
| InChI | InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/p+1/t10-,11+,13-,16-,17-/m0/s1 |
| InChIKey | BQJCRHHNABKAKU-KBQPJGBKSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| morphine(1+) (CHEBI:58097) is a ammonium ion derivative (CHEBI:35274) |
| morphine(1+) (CHEBI:58097) is a organic cation (CHEBI:25697) |
| morphine(1+) (CHEBI:58097) is conjugate acid of morphine (CHEBI:17303) |
| Incoming Relation(s) |
| morphine (CHEBI:17303) is conjugate base of morphine(1+) (CHEBI:58097) |
| IUPAC Name |
|---|
| 17-methyl-7,8-didehydro-4,5α-epoxymorphinan-17-ium-3,6α-diol |
| Synonym | Source |
|---|---|
| morphine cation | ChEBI |
| UniProt Name | Source |
|---|---|
| morphine | UniProt |