EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5O8 |
| Net Charge | -3 |
| Average Mass | 217.109 |
| Monoisotopic Mass | 217.00009 |
| SMILES | O=C([O-])CC(O)(CC(=O)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H8O8/c8-3(5(11)12)1-7(15,6(13)14)2-4(9)10/h15H,1-2H2,(H,9,10)(H,11,12)(H,13,14)/p-3 |
| InChIKey | RQMCNDRMPZBEOD-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate (CHEBI:58075) is a tricarboxylic acid trianion (CHEBI:27092) |
| 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate (CHEBI:58075) is conjugate base of 2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid (CHEBI:17250) |
| Incoming Relation(s) |
| (2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylate (CHEBI:142706) is a 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate (CHEBI:58075) |
| 2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid (CHEBI:17250) is conjugate acid of 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate (CHEBI:58075) |
| IUPAC Name |
|---|
| 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate |
| UniProt Name | Source |
|---|---|
| 2-hydroxy-4-oxobutane-1,2,4-tricarboxylate | UniProt |