EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15O8 |
| Net Charge | -1 |
| Average Mass | 359.310 |
| Monoisotopic Mass | 359.07724 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC(Cc1ccc(O)c(O)c1)C(=O)[O-] |
| InChI | InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)3-6-17(23)26-16(18(24)25)9-11-2-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,24,25)/p-1/b6-3+ |
| InChIKey | DOUMFZQKYFQNTF-ZZXKWVIFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosmarinate (CHEBI:58062) is a monocarboxylic acid anion (CHEBI:35757) |
| rosmarinate (CHEBI:58062) is conjugate base of rosmarinic acid (CHEBI:17226) |
| Incoming Relation(s) |
| (R)-rosmarinate (CHEBI:71493) is a rosmarinate (CHEBI:58062) |
| rosmarinic acid (CHEBI:17226) is conjugate acid of rosmarinate (CHEBI:58062) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-2-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoate |
| Synonyms | Source |
|---|---|
| rosmarinate(1−) | ChEBI |
| rosmarinate anion | ChEBI |