EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O4 |
| Net Charge | -2 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02771 |
| SMILES | C=C(CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H8O4/c1-4(6(9)10)2-3-5(7)8/h1-3H2,(H,7,8)(H,9,10)/p-2 |
| InChIKey | CWNNYYIZGGDCHS-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylideneglutarate(2−) (CHEBI:58056) is a dicarboxylic acid dianion (CHEBI:28965) |
| 2-methylideneglutarate(2−) (CHEBI:58056) is conjugate base of 2-methylideneglutaric acid (CHEBI:17207) |
| Incoming Relation(s) |
| 2-methylideneglutaric acid (CHEBI:17207) is conjugate acid of 2-methylideneglutarate(2−) (CHEBI:58056) |
| IUPAC Name |
|---|
| 2-methylenepentanedioate |
| Synonyms | Source |
|---|---|
| 2-methylidenepentanedioate | ChEBI |
| 2-methylideneglutarate dianion | ChEBI |
| 2-methyleneglutarate dianion | ChEBI |
| 2-methylenepentanedioate | ChEBI |
| 2-methyleneglutarate(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methyleneglutarate | UniProt |