EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N4O8P |
| Net Charge | -2 |
| Average Mass | 346.192 |
| Monoisotopic Mass | 346.03255 |
| SMILES | O=c1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13N4O8P/c15-6-4(1-21-23(18,19)20)22-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-4,6-7,10,15-16H,1H2,(H,11,12,17)(H2,18,19,20)/p-2/t4-,6-,7-,10-/m1/s1 |
| InChIKey | GRSZFWQUAKGDAV-KQYNXXCUSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IMP(2−) (CHEBI:58053) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| IMP(2−) (CHEBI:58053) has role human metabolite (CHEBI:77746) |
| IMP(2−) (CHEBI:58053) is a nucleoside 5'-monophosphate(2−) (CHEBI:58043) |
| IMP(2−) (CHEBI:58053) is conjugate base of IMP (CHEBI:17202) |
| Incoming Relation(s) |
| 6-mercaptopurine riboside 5'-phosphate(2−) (CHEBI:145875) has functional parent IMP(2−) (CHEBI:58053) |
| IMP (CHEBI:17202) is conjugate acid of IMP(2−) (CHEBI:58053) |
| IUPAC Name |
|---|
| 5'-O-phosphonatoinosine |
| Synonyms | Source |
|---|---|
| IMP dianion | ChEBI |
| inosine 5'-phosphate | ChEBI |
| inosine 5'-phosphate(2−) | ChEBI |
| inosine 5'-phosphate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| IMP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4163247 | Reaxys |