EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CC[C@H](C)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 |
| InChIKey | AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-isoleucine zwitterion (CHEBI:58045) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-isoleucine zwitterion (CHEBI:58045) is tautomer of L-isoleucine (CHEBI:17191) |
| Incoming Relation(s) |
| L-isoleucine (CHEBI:17191) is tautomer of L-isoleucine zwitterion (CHEBI:58045) |
| IUPAC Name |
|---|
| (2S,3S)-2-azaniumyl-3-methylpentanoate |
| Synonym | Source |
|---|---|
| (2S,3S)-2-ammonio-3-methylpentanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| L-isoleucine | UniProt |