EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H12N3O4P |
| Net Charge | 0 |
| Average Mass | 197.131 |
| Monoisotopic Mass | 197.05654 |
| SMILES | COP(=O)([O-])OCCNC(N)=[NH2+] |
| InChI | InChI=1S/C4H12N3O4P/c1-10-12(8,9)11-3-2-7-4(5)6/h2-3H2,1H3,(H,8,9)(H4,5,6,7) |
| InChIKey | PTALSLHNZQRENZ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanidinoethyl methyl phosphate zwitterion (CHEBI:58042) is a zwitterion (CHEBI:27369) |
| guanidinoethyl methyl phosphate zwitterion (CHEBI:58042) is tautomer of guanidinoethyl methyl phosphate (CHEBI:17175) |
| Incoming Relation(s) |
| guanidinoethyl methyl phosphate (CHEBI:17175) is tautomer of guanidinoethyl methyl phosphate zwitterion (CHEBI:58042) |
| IUPAC Name |
|---|
| 2-{[amino(iminio)methyl]amino}ethyl methyl phosphate |
| UniProt Name | Source |
|---|---|
| guanidinoethyl methyl phosphate | UniProt |