EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N7O5 |
| Net Charge | +1 |
| Average Mass | 458.499 |
| Monoisotopic Mass | 458.21464 |
| SMILES | CN(C)c1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](NC(=O)[C@@H]([NH3+])Cc2ccc(O)cc2)[C@H]1O |
| InChI | InChI=1S/C21H27N7O5/c1-27(2)18-16-19(24-9-23-18)28(10-25-16)21-17(31)15(14(8-29)33-21)26-20(32)13(22)7-11-3-5-12(30)6-4-11/h3-6,9-10,13-15,17,21,29-31H,7-8,22H2,1-2H3,(H,26,32)/p+1/t13-,14+,15+,17+,21+/m0/s1 |
| InChIKey | NVZJDPXVSWFFJJ-YXDKPKCJSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-demethylpuromycin(1+) (CHEBI:58037) is a ammonium ion derivative (CHEBI:35274) |
| O-demethylpuromycin(1+) (CHEBI:58037) is a organic cation (CHEBI:25697) |
| O-demethylpuromycin(1+) (CHEBI:58037) is conjugate acid of O-demethylpuromycin (CHEBI:17161) |
| Incoming Relation(s) |
| O-demethylpuromycin (CHEBI:17161) is conjugate base of O-demethylpuromycin(1+) (CHEBI:58037) |
| IUPAC Name |
|---|
| 3'-deoxy-N,N-dimethyl-3'-(L-tyrosiniumamido)adenosine |
| Synonym | Source |
|---|---|
| O-demethylpuromycin cation | ChEBI |
| UniProt Name | Source |
|---|---|
| O-demethylpuromycin | UniProt |