EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18NO9S2 |
| Net Charge | -1 |
| Average Mass | 408.430 |
| Monoisotopic Mass | 408.04285 |
| SMILES | O=S(=O)([O-])O/N=C(/Cc1ccccc1)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19NO9S2/c16-7-9-11(17)12(18)13(19)14(23-9)25-10(15-24-26(20,21)22)6-8-4-2-1-3-5-8/h1-5,9,11-14,16-19H,6-7H2,(H,20,21,22)/p-1/b15-10-/t9-,11-,12+,13-,14+/m1/s1 |
| InChIKey | QQGLQYQXUKHWPX-RFEZBLSLSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carica papaya (ncbitaxon:3649) | - | PubMed (22305790) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucotropeolin(1−) (CHEBI:58021) is a (Z)-glucosinolate(1−) (CHEBI:183098) |
| glucotropeolin(1−) (CHEBI:58021) is a aralkylglucosinolate (CHEBI:36452) |
| glucotropeolin(1−) (CHEBI:58021) is conjugate base of glucotropeolin (CHEBI:17127) |
| Incoming Relation(s) |
| (Z)-phenyl-N-(sulfonatooxy)methanimidothioate (CHEBI:183061) has functional parent glucotropeolin(1−) (CHEBI:58021) |
| glucotropeolin (CHEBI:17127) is conjugate acid of glucotropeolin(1−) (CHEBI:58021) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-2-phenyl-N-(sulfonatooxy)ethanimidoyl]-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| glucotropeolin anion | ChEBI |
| UniProt Name | Source |
|---|---|
| (Z)-glucotropeolin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1671233 | Reaxys |