EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2 |
| Net Charge | 0 |
| Average Mass | 89.094 |
| Monoisotopic Mass | 89.04768 |
| SMILES | C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 |
| InChIKey | QNAYBMKLOCPYGJ-REOHCLBHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-alanine zwitterion (CHEBI:57972) is a alanine zwitterion (CHEBI:66916) |
| L-alanine zwitterion (CHEBI:57972) is tautomer of L-alanine (CHEBI:16977) |
| Incoming Relation(s) |
| L-alanine (CHEBI:16977) is tautomer of L-alanine zwitterion (CHEBI:57972) |
| IUPAC Name |
|---|
| (2S)-2-azaniumylpropanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammoniopropanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| L-alanine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:362662 | Gmelin |