EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H33MgN4O5 |
| Net Charge | -1 |
| Average Mass | 613.977 |
| Monoisotopic Mass | 613.23069 |
| SMILES | C=Cc1c(C)c2[n]3c1=CC1=[N+]4C(=Cc5c(C)c6c7[n]5[Mg-2]34[N+]3=C(C=2)[C@@H](C)[C@H](CCC(=O)[O-])C3=C7[C@@H](C(=O)OC)C6=O)C(CC)=C1C |
| InChI | InChI=1S/C35H36N4O5.Mg/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22;/h8,12-14,17,21,31H,1,9-11H2,2-7H3,(H3,36,37,38,39,40,41,42);/q;+2/p-3/t17-,21-,31+;/m0./s1 |
| InChIKey | ANWUQYTXRXCEMZ-NYABAGMLSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorophyllide a(1−) (CHEBI:57942) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| chlorophyllide a(1−) (CHEBI:57942) is conjugate acid of chlorophyllide a(2−) (CHEBI:83348) |
| chlorophyllide a(1−) (CHEBI:57942) is conjugate base of chlorophyllide a (CHEBI:16900) |
| Incoming Relation(s) |
| chlorophyllide a (CHEBI:16900) is conjugate acid of chlorophyllide a(1−) (CHEBI:57942) |
| chlorophyllide a(2−) (CHEBI:83348) is conjugate base of chlorophyllide a(1−) (CHEBI:57942) |
| Synonym | Source |
|---|---|
| chlorophyllide a anion | ChEBI |