EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5NO4 |
| Net Charge | -2 |
| Average Mass | 155.109 |
| Monoisotopic Mass | 155.02295 |
| SMILES | N/C(=C\C=C\C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H7NO4/c7-4(6(10)11)2-1-3-5(8)9/h1-3H,7H2,(H,8,9)(H,10,11)/p-2/b3-1+,4-2- |
| InChIKey | ZRHONLCTYUYMIQ-TZFCGSKZSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4E)-2-aminomuconate(2−) (CHEBI:57937) has role human metabolite (CHEBI:77746) |
| (2Z,4E)-2-aminomuconate(2−) (CHEBI:57937) is a 2-aminomuconate (CHEBI:189700) |
| (2Z,4E)-2-aminomuconate(2−) (CHEBI:57937) is conjugate base of (2Z,4E)-2-aminomuconic acid (CHEBI:189697) |
| (2Z,4E)-2-aminomuconate(2−) (CHEBI:57937) is conjugate base of (2Z,4E)-2-ammoniomuconate(1−) (CHEBI:77859) |
| Incoming Relation(s) |
| (2Z,4E)-2-aminomuconic acid (CHEBI:189697) is conjugate acid of (2Z,4E)-2-aminomuconate(2−) (CHEBI:57937) |
| (2Z,4E)-2-ammoniomuconate(1−) (CHEBI:77859) is conjugate acid of (2Z,4E)-2-aminomuconate(2−) (CHEBI:57937) |
| IUPAC Name |
|---|
| (2Z,4E)-2-aminohexa-2,4-dienedioate |
| Synonyms | Source |
|---|---|
| (2Z,4E)-2-aminomuconate | ChEBI |
| (2Z,4E)-2-aminomuconic acid dianion | ChEBI |