EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N5O14P2 |
| Net Charge | -2 |
| Average Mass | 557.302 |
| Monoisotopic Mass | 557.05712 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OC2O[C@H](CO)[C@@H](O)[C@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H23N5O14P2/c16-12-7-13(18-3-17-12)20(4-19-7)14-10(24)9(23)6(31-14)2-30-35(26,27)34-36(28,29)33-15-11(25)8(22)5(1-21)32-15/h3-6,8-11,14-15,21-25H,1-2H2,(H,26,27)(H,28,29)(H2,16,17,18)/p-2/t5-,6-,8-,9-,10-,11-,14-,15?/m1/s1 |
| InChIKey | SDMADEZQMYCSNO-TYASJMOZSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-ribofuranosyl-ADP(2−) (CHEBI:57931) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| D-ribofuranosyl-ADP(2−) (CHEBI:57931) is conjugate base of D-ribofuranosyl-ADP (CHEBI:16864) |
| Incoming Relation(s) |
| D-ribofuranosyl-ADP (CHEBI:16864) is conjugate acid of D-ribofuranosyl-ADP(2−) (CHEBI:57931) |
| IUPAC Name |
|---|
| adenosine 5'-[3-(D-ribofuranosyl) diphosphate] |