EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4NO3 |
| Net Charge | -1 |
| Average Mass | 138.102 |
| Monoisotopic Mass | 138.01967 |
| SMILES | O=[N+]([O-])c1ccc([O-])cc1 |
| InChI | InChI=1S/C6H5NO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H/p-1 |
| InChIKey | BTJIUGUIPKRLHP-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-nitrophenolate (CHEBI:57917) has role human xenobiotic metabolite (CHEBI:76967) |
| 4-nitrophenolate (CHEBI:57917) is a phenolate anion (CHEBI:50525) |
| 4-nitrophenolate (CHEBI:57917) is conjugate base of 4-nitrophenol (CHEBI:16836) |
| Incoming Relation(s) |
| 4-nitrophenol (CHEBI:16836) is conjugate acid of 4-nitrophenolate (CHEBI:57917) |
| IUPAC Name |
|---|
| 4-nitrophenolate |
| Synonyms | Source |
|---|---|
| 4-nitrobenzen-1-olate | ChEBI |
| 4-nitrophenolate(1−) | ChEBI |
| 4-nitrophenolate anion | ChEBI |
| p-nitrophenolate | ChEBI |
| p-nitrophenolate(1−) | ChEBI |
| p-nitrophenolate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-nitrophenol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:3310 | Gmelin |
| Beilstein:3589511 | Beilstein |