EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N2O2 |
| Net Charge | +1 |
| Average Mass | 337.443 |
| Monoisotopic Mass | 337.19105 |
| SMILES | [H][C@]12[NH+]3CC=C[C@@]1(CC)CC(C(=O)OC)=C1Nc4ccccc4[C@@]12CC3 |
| InChI | InChI=1S/C21H24N2O2/c1-3-20-9-6-11-23-12-10-21(19(20)23)15-7-4-5-8-16(15)22-17(21)14(13-20)18(24)25-2/h4-9,19,22H,3,10-13H2,1-2H3/p+1/t19-,20-,21-/m0/s1 |
| InChIKey | FNGGIPWAZSFKCN-ACRUOGEOSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tabersoninium(1+) (CHEBI:57893) is a indole alkaloid cation (CHEBI:60521) |
| tabersoninium(1+) (CHEBI:57893) is conjugate acid of tabersonine (CHEBI:16776) |
| Incoming Relation(s) |
| tabersonine (CHEBI:16776) is conjugate base of tabersoninium(1+) (CHEBI:57893) |
| IUPAC Name |
|---|
| methyl 2,3,6,7-tetradehydro-5α,12β,19α-aspidospermidin-9-ium-3-carboxylate |
| Synonyms | Source |
|---|---|
| tabersonine(1+) | ChEBI |
| tabersonine cation | ChEBI |
| tabersoninium | ChEBI |
| tabersoninium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| (−)-tabersonine | UniProt |