EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7O4 |
| Net Charge | -1 |
| Average Mass | 155.129 |
| Monoisotopic Mass | 155.03498 |
| SMILES | CC1=CC(=O)OC1CC(=O)[O-] |
| InChI | InChI=1S/C7H8O4/c1-4-2-7(10)11-5(4)3-6(8)9/h2,5H,3H2,1H3,(H,8,9)/p-1 |
| InChIKey | GXEVIPDDAUJTCF-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carboxylatomethyl-3-methylbut-2-en-1,4-olide(1−) (CHEBI:57883) is a monocarboxylic acid anion (CHEBI:35757) |
| 4-carboxylatomethyl-3-methylbut-2-en-1,4-olide(1−) (CHEBI:57883) is conjugate base of 4-carboxymethyl-3-methylbut-2-en-1,4-olide (CHEBI:16754) |
| Incoming Relation(s) |
| 4-carboxymethyl-3-methylbut-2-en-1,4-olide (CHEBI:16754) is conjugate acid of 4-carboxylatomethyl-3-methylbut-2-en-1,4-olide(1−) (CHEBI:57883) |
| IUPAC Name |
|---|
| (3-methyl-5-oxo-2,5-dihydrofuran-2-yl)acetate |
| Synonyms | Source |
|---|---|
| 2-(3-methyl-5-oxo-2,5-dihydrofuran-2-yl)acetate | ChEBI |
| 4-carboxylatomethyl-3-methylbut-2-en-1,4-olide | ChEBI |
| 4-carboxylatomethyl-3-methylbut-2-en-1,4-olide anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-methylmuconolactone | UniProt |