EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N2O3 |
| Net Charge | -1 |
| Average Mass | 245.258 |
| Monoisotopic Mass | 245.09317 |
| SMILES | CC(=O)N[C@H](Cc1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C13H14N2O3/c1-8(16)15-12(13(17)18)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,15,16)(H,17,18)/p-1/t12-/m1/s1 |
| InChIKey | DZTHIGRZJZPRDV-GFCCVEGCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-D-tryptophanate (CHEBI:57877) has functional parent D-tryptophanate (CHEBI:32716) |
| N-acetyl-D-tryptophanate (CHEBI:57877) is a N-acyl-D-α-amino acid anion (CHEBI:59876) |
| N-acetyl-D-tryptophanate (CHEBI:57877) is conjugate base of N-acetyl-D-tryptophan (CHEBI:16734) |
| N-acetyl-D-tryptophanate (CHEBI:57877) is enantiomer of N-acetyl-L-tryptophanate (CHEBI:143877) |
| Incoming Relation(s) |
| N-acetyl-D-tryptophan (CHEBI:16734) is conjugate acid of N-acetyl-D-tryptophanate (CHEBI:57877) |
| N-acetyl-L-tryptophanate (CHEBI:143877) is enantiomer of N-acetyl-D-tryptophanate (CHEBI:57877) |
| IUPAC Names |
|---|
| (2R)-2-acetamido-3-(1H-indol-3-yl)propanoate |
| N-acetyl-D-tryptophanate |
| Synonyms | Source |
|---|---|
| N-acetyl-D-tryptophanate(1−) | ChEBI |
| N-acetyl-D-tryptophanate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| N-acetyl-D-tryptophan | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5294452 | Beilstein |