EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17O11P |
| Net Charge | -2 |
| Average Mass | 332.198 |
| Monoisotopic Mass | 332.05195 |
| SMILES | O=P([O-])([O-])OC[C@@H](CO)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H19O11P/c10-1-4(3-18-21(15,16)17)19-9-8(14)7(13)6(12)5(2-11)20-9/h4-14H,1-3H2,(H2,15,16,17)/p-2/t4-,5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | PLJAVYDLNJODGD-VMQOHUEUSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-(β-D-glucosyl)-sn-glycerol 3-phosphate(2−) (CHEBI:57874) is a organophosphate oxoanion (CHEBI:58945) |
| 2-O-(β-D-glucosyl)-sn-glycerol 3-phosphate(2−) (CHEBI:57874) is conjugate base of 2-O-(β-D-glucosyl)-sn-glycerol 3-phosphate (CHEBI:16720) |
| Incoming Relation(s) |
| 2-O-(β-D-glucosyl)-sn-glycerol 3-phosphate (CHEBI:16720) is conjugate acid of 2-O-(β-D-glucosyl)-sn-glycerol 3-phosphate(2−) (CHEBI:57874) |
| IUPAC Name |
|---|
| (2R)-2-(β-D-glucopyranosyloxy)-3-hydroxypropyl phosphate |
| Synonym | Source |
|---|---|
| 2-O-(β-D-glucosyl)-sn-glycerol 3-phosphate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-O-(β-D-glucopyranosyl)-sn-glycerol 3-phosphate | UniProt |