EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5O6 |
| Net Charge | -3 |
| Average Mass | 185.111 |
| Monoisotopic Mass | 185.01026 |
| SMILES | C/C(C(=O)[O-])=C(\CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H8O6/c1-3(6(10)11)4(7(12)13)2-5(8)9/h2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/p-3/b4-3- |
| InChIKey | NUZLRKBHOBPTQV-ARJAWSKDSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-but-2-ene-1,2,3-tricarboxylate (CHEBI:57872) has role human metabolite (CHEBI:77746) |
| (Z)-but-2-ene-1,2,3-tricarboxylate (CHEBI:57872) is a tricarboxylic acid trianion (CHEBI:27092) |
| (Z)-but-2-ene-1,2,3-tricarboxylate (CHEBI:57872) is conjugate base of (Z)-but-2-ene-1,2,3-tricarboxylic acid (CHEBI:16717) |
| Incoming Relation(s) |
| (Z)-but-2-ene-1,2,3-tricarboxylic acid (CHEBI:16717) is conjugate acid of (Z)-but-2-ene-1,2,3-tricarboxylate (CHEBI:57872) |
| IUPAC Name |
|---|
| (2Z)-but-2-ene-1,2,3-tricarboxylate |
| Synonym | Source |
|---|---|
| (1Z)-1-methylprop-1-ene-1,2,3-tricarboxylate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methyl-cis-aconitate | UniProt |