EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24NO3 |
| Net Charge | +1 |
| Average Mass | 290.383 |
| Monoisotopic Mass | 290.17507 |
| SMILES | C[NH+]1[C@@H]2CC[C@H]1C[C@@H](OC(=O)C(CO)c1ccccc1)C2 |
| InChI | InChI=1S/C17H23NO3/c1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/p+1/t13-,14+,15+,16? |
| InChIKey | RKUNBYITZUJHSG-SPUOUPEWSA-O |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atropinium (CHEBI:57858) has role plant metabolite (CHEBI:76924) |
| atropinium (CHEBI:57858) is a ammonium ion derivative (CHEBI:35274) |
| atropinium (CHEBI:57858) is conjugate acid of tropan-3α-yl 3-hydroxy-2-phenylpropanoate (CHEBI:78734) |
| Incoming Relation(s) |
| tropan-3α-yl 3-hydroxy-2-phenylpropanoate (CHEBI:78734) is conjugate base of atropinium (CHEBI:57858) |
| IUPAC Name |
|---|
| (3-endo,8-syn)-3-[(3-hydroxy-2-phenylpropanoyl)oxy]-8-methyl-8-azoniabicyclo[3.2.1]octane |
| Synonyms | Source |
|---|---|
| atropinium(1+) | ChEBI |
| atropinium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| atropine | UniProt |