EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14NO |
| Net Charge | +1 |
| Average Mass | 140.206 |
| Monoisotopic Mass | 140.10699 |
| SMILES | C[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 |
| InChI | InChI=1S/C8H13NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-7H,2-5H2,1H3/p+1/t6-,7+ |
| InChIKey | QQXLDOJGLXJCSE-KNVOCYPGSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropiniumone (CHEBI:57851) is a ammonium ion derivative (CHEBI:35274) |
| tropiniumone (CHEBI:57851) is conjugate acid of tropinone (CHEBI:16656) |
| Incoming Relation(s) |
| tropinone (CHEBI:16656) is conjugate base of tropiniumone (CHEBI:57851) |
| IUPAC Name |
|---|
| (8-syn)-8-methyl-3-oxo-8-azoniabicyclo[3.2.1]octane |
| Synonyms | Source |
|---|---|
| tropiniumone(1+) | ChEBI |
| tropiniumone cation | ChEBI |
| tropinone cation | ChEBI |
| UniProt Name | Source |
|---|---|
| tropinone | UniProt |