EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5782 - Hydrocortisone Sodium Succinate
| Formula | C25H33O8.Na |
| Net Charge | 0 |
| Average Mass | 484.521 |
| Monoisotopic Mass | 484.20731 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(=O)CCC(=O)[O-])[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C.[Na+] |
| InChI | InChI=1S/C25H34O8.Na/c1-23-9-7-15(26)11-14(23)3-4-16-17-8-10-25(32,24(17,2)12-18(27)22(16)23)19(28)13-33-21(31)6-5-20(29)30;/h11,16-18,22,27,32H,3-10,12-13H2,1-2H3,(H,29,30);/q;+1/p-1/t16-,17-,18-,22+,23-,24-,25-;/m0./s1 |
| InChIKey | HHZQLQREDATOBM-CODXZCKSSA-M |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydrocortisone Sodium Succinate (CHEBI:5782) has role anti-asthmatic agent (CHEBI:65023) |
| Hydrocortisone Sodium Succinate (CHEBI:5782) has role antineoplastic agent (CHEBI:35610) |
| Hydrocortisone Sodium Succinate (CHEBI:5782) is a corticosteroid hormone (CHEBI:36699) |
| Hydrocortisone Sodium Succinate (CHEBI:5782) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Cortisol 21-(sodium succinate) | ChEMBL |
| Hydrocortisone 21-sodium succinate | ChEMBL |
| Hydrocortisone Sodium Succinate | KEGG COMPOUND |
| Hydrocortisoni natrii succinas | ChEMBL |
| NSC-9152 | ChEMBL |
| Brand Names | Source |
|---|---|
| A-hydrocort | ChEMBL |
| Hcss | ChEMBL |
| Citations |
|---|