EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33O8.Na |
| Net Charge | 0 |
| Average Mass | 484.521 |
| Monoisotopic Mass | 484.20731 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(=O)CCC(=O)[O-])[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C.[Na+] |
| InChI | InChI=1S/C25H34O8.Na/c1-23-9-7-15(26)11-14(23)3-4-16-17-8-10-25(32,24(17,2)12-18(27)22(16)23)19(28)13-33-21(31)6-5-20(29)30;/h11,16-18,22,27,32H,3-10,12-13H2,1-2H3,(H,29,30);/q;+1/p-1/t16-,17-,18-,22+,23-,24-,25-;/m0./s1 |
| InChIKey | HHZQLQREDATOBM-CODXZCKSSA-M |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydrocortisone Sodium Succinate (CHEBI:5782) has role anti-asthmatic agent (CHEBI:65023) |
| Hydrocortisone Sodium Succinate (CHEBI:5782) has role antineoplastic agent (CHEBI:35610) |
| Hydrocortisone Sodium Succinate (CHEBI:5782) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Cortisol 21-(sodium succinate) | ChEMBL |
| Hydrocortisone 21-sodium succinate | ChEMBL |
| Hydrocortisone Sodium Succinate | KEGG COMPOUND |
| Hydrocortisoni natrii succinas | ChEMBL |
| NSC-9152 | ChEMBL |
| Brand Names | Source |
|---|---|
| A-hydrocort | ChEMBL |
| Hcss | ChEMBL |
| Citations |
|---|