EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | O9P3 |
| Net Charge | -3 |
| Average Mass | 236.913 |
| Monoisotopic Mass | 236.87716 |
| SMILES | O=P1([O-])OP(=O)([O-])OP(=O)([O-])O1 |
| InChI | InChI=1S/H3O9P3/c1-10(2)7-11(3,4)9-12(5,6)8-10/h(H,1,2)(H,3,4)(H,5,6)/p-3 |
| InChIKey | AZSFNUJOCKMOGB-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclotriphosphate(3−) (CHEBI:57801) is a triphosphate ion (CHEBI:15266) |
| cyclotriphosphate(3−) (CHEBI:57801) is a trivalent inorganic anion (CHEBI:79387) |
| cyclotriphosphate(3−) (CHEBI:57801) is conjugate base of cyclotriphosphoric acid (CHEBI:16517) |
| Incoming Relation(s) |
| cyclotriphosphoric acid (CHEBI:16517) is conjugate acid of cyclotriphosphate(3−) (CHEBI:57801) |
| IUPAC Name |
|---|
| 1,3,5,2,4,6-trioxatriphosphinane-2,4,6-triolate 2,4,6-trioxide |
| Synonym | Source |
|---|---|
| cyclotriphosphate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| trimetaphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:185242 | Gmelin |